(Chloromethyl)diphenylphosphine Oxide
[chloromethyl(phenyl)phosphoryl]benzene
Also Known As: (Chloromethyl)diphenylphosphine Oxide|ACMC-20lkjg|[chloromethyl(phenyl)phosphoryl]benzene|Methyl, chloro(diphenylphosphinyl)-|(Chloromethyl)diphenyl-phosphine Oxide|(chloromethyl)(diphenyl)phosphane oxide|[(chloromethyl)(phenyl)phosphoroso]benzene|diphenyl(chloromethyl)phosphine oxide|Phosphine oxide, (chloromethyl)diphenyl-|(Chloromethyl)(diphenyl)phosphine oxide|(Chloromethyl)diphenyl-phosphine Oxide;|Phosphine, chloromethyldiphenyl-, oxide|(Chloromethyl)(diphenyl)phosphine oxide #|(Chloromethyl)diphenylphosphine oxide, 97%|F2163-0198
| Molecular Formula | C13H12ClOP |
|---|---|
| Molecular Weight | 250.03143 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 250.03143 |
| Monoisotopic Mass | 250.03143 |
| Heavy Atoms | 16 |
| Complexity | 233.0 |
Chemical Identifiers
| CAS Number | 89302-51-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(=O)(CCl)C2=CC=CC=C2 |
| InChIKey | IGPFFLDNJJJXHV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(Chloromethyl)diphenylphosphine Oxide (CAS 89302-51-2), with molecular formula C13H12ClOP and molecular weight 250.03143 g/mol. IUPAC: [chloromethyl(phenyl)phosphoryl]benzene.