2-Anilino-6-dibutylamino-3-methylfluoran
2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one
Also Known As: 2-Anilino-6-dibutylamino-3-methylfluoran|odb-two|2-Anilino-3-methyl-6-(dibutylamino)fluoran|Fluorane leuco dye|ODB-2|Black 400|ODB2|COPIKEM 34 BLACK|ck-68|6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one|PERGASCRIPT BLACK 2C|2-phenylamino-3-methyl-6-di-n-butylaminofluoran|2'-Anilino-6'-(dibutylamino)-3'-methylfluoran|3-dibutylamino-6-methyl-7-anilinofluoran|P406|2-anilino-6-dibutylamino-3-methylfluorane|EC 403-830-5|2-Anilino-6-(dibutylamino)-3-methylfluoran
| Molecular Formula | C35H36N2O3 |
|---|---|
| Molecular Weight | 532.2726 g/mol |
| LogP | 8.71322 |
| Topological Polar Surface Area | 50.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 532.2726 |
| Monoisotopic Mass | 532.2726 |
| Heavy Atoms | 40 |
| Complexity | 1540.0232 |
Chemical Identifiers
| CAS Number | 89331-94-2 |
|---|---|
| SMILES | CCCCN(CCCC)C1=CC2=C(C=C1)C3(C4=CC=CC=C4C(=O)O3)C5=C(O2)C=C(C(=C5)NC6=CC=CC=C6)C |
Product Overview
2-Anilino-6-dibutylamino-3-methylfluoran (CAS 89331-94-2), with molecular formula C35H36N2O3 and molecular weight 532.2726 g/mol. IUPAC: 2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.