1H-Imidazole, 1-(3,3-dimethyl-1-oxo-2-((4-(trifluoromethyl)phenyl)methyl)butyl)-
1-imidazol-1-yl-3,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-one
Also Known As: 1H-Imidazole, 1-(3,3-dimethyl-1-oxo-2-((4-(trifluoromethyl)phenyl)methyl)butyl)-|1-(1H-Imidazol-1-yl)-3,3-dimethyl-2-(4-(trifluoromethyl)benzyl)butan-1-one|1-imidazol-1-yl-3,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-one|1-(1H-imidazol-1-yl)-3,3-dimethyl-2-[4-(trifluoromethyl)benzyl]butan-1-one|1-(1H-Imidazol-1-yl)-3,3-dimethyl-2-{[4-(trifluoromethyl)phenyl]methyl}butan-1-one
| Molecular Formula | C17H19F3N2O |
|---|---|
| Molecular Weight | 324.14496 g/mol |
| LogP | 4.4 |
| Topological Polar Surface Area | 34.9 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 324.14496 |
| Monoisotopic Mass | 324.14496 |
| Heavy Atoms | 23 |
| Complexity | 409.0 |
Chemical Identifiers
| CAS Number | 89372-63-4 |
|---|---|
| SMILES | CC(C)(C)C(CC1=CC=C(C=C1)C(F)(F)F)C(=O)N2C=CN=C2 |
| InChIKey | JEBBAPPSBPQCQN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1H-Imidazole, 1-(3,3-dimethyl-1-oxo-2-((4-(trifluoromethyl)phenyl)methyl)butyl)- (CAS 89372-63-4), with molecular formula C17H19F3N2O and molecular weight 324.14496 g/mol. IUPAC: 1-imidazol-1-yl-3,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-one.