1,2-Bis(4-chlorobenzoyl)-hydrazine
4-chloro-N'-(4-chlorobenzoyl)benzohydrazide
Also Known As: di-4ClPhCO hydr|4-chloro-N'-(4-chlorobenzoyl)benzohydrazide|NCIOpen2_007985|1,2-Bis(4-chlorobenzoyl)hydrazine|1,2-BIS(4-CHLOROBENZOYL)-HYDRAZINE|1,2-bis-( 4-chlorobenzoyl)-hydrazine|neopentyl-1-phenylvinyl phenylphosphonate|BAS 01516794|4-Chloro-benzoic acid N'-(4-chloro-benzoyl)-hydrazide|4-chloro-N'-[(4-chlorophenyl)carbonyl]benzohydrazide|(4-chlorophenyl)-N-[(4-chlorophenyl)carbonylamino]carboxamide|4-Chloro-N-[(4-chlorophenyl)(hydroxy)methylidene]benzene-1-carbohydrazonic acid|654-710-6
| Molecular Formula | C14H10Cl2N2O2 |
|---|---|
| Molecular Weight | 308.01193 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 58.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 308.01193 |
| Monoisotopic Mass | 308.01193 |
| Heavy Atoms | 20 |
| Complexity | 315.0 |
Chemical Identifiers
| CAS Number | 895-84-1 |
|---|---|
| SMILES | C1=CC(=CC=C1C(=O)NNC(=O)C2=CC=C(C=C2)Cl)Cl |
| InChIKey | YBFRTDHRYMNDLU-UHFFFAOYSA-N |
Product Overview
1,2-Bis(4-chlorobenzoyl)-hydrazine (CAS 895-84-1), with molecular formula C14H10Cl2N2O2 and molecular weight 308.01193 g/mol. IUPAC: 4-chloro-N'-(4-chlorobenzoyl)benzohydrazide.
1,2-Bis(4-chlorobenzoyl)-hydrazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »