Methyltriphenylphosphonium chloride
methyl(triphenyl)phosphanium chloride
Also Known As: Methyltriphenylphosphonium chloride|Methyl(triphenyl)phosphonium chloride|TPMP-Cl|Methyl phosphoniumchloride|Methyl triphenyl phosphonium chloride|methyl(triphenyl)phosphanium;chloride|methyltriphenylphosphanium chloride|triphenylmethylphosphonium chloride|methyl triphenylphosphonium chloride|MethyltriphenylphosphoniumChloride|KS-00000EPW|methyl(triphenyl)phosphanium chloride|methyl(triphenyl)phosphonium;chloride|Methyltri(phenyl)phosphanium chloride|AC2468|EC 418-400-2|Methyl-triphenyl-phosphanium Chloride|Methyl(triphenyl) phosphonium Chloride|CS-W012048|PHOSPHONIUM, METHYLTRIPHENYL-, CHLORIDE|B-150|(Methyl)triphenylphosphonium chloride 97%
| Molecular Formula | C19H18ClP |
|---|---|
| Molecular Weight | 312.08347 g/mol |
| LogP | 0.6143 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 312.08347 |
| Monoisotopic Mass | 312.08347 |
| Heavy Atoms | 21 |
| Complexity | 569.03925 |
Chemical Identifiers
| CAS Number | 896-33-3 |
|---|---|
| SMILES | C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Product Overview
Methyltriphenylphosphonium chloride (CAS 896-33-3), with molecular formula C19H18ClP and molecular weight 312.08347 g/mol. IUPAC: methyl(triphenyl)phosphanium chloride.