CID7384618
7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one
Also Known As: BRD-K11305452-001-01-6|F2669-0061|7-{1,4-dioxa-8-azaspiro[4.5]decane-8-sulfonyl}-1-azatricyclo[7.3.1.0^{5,13}]trideca-5,7,9(13)-trien-2-one|9-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-1,2,6,7-tetrahydropyrido[3,2,1-ij]quinolin-3(5H)-one|7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one|9-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylsulfonyl)-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-5-one
| Molecular Formula | C19H24N2O5S |
|---|---|
| Molecular Weight | 392.1406 g/mol |
| LogP | 1.4396 |
| Topological Polar Surface Area | 76.15 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 392.1406 |
| Monoisotopic Mass | 392.1406 |
| Heavy Atoms | 27 |
| Complexity | 864.35626 |
Chemical Identifiers
| CAS Number | 896357-09-8 |
|---|---|
| SMILES | C1CC2=C3C(=CC(=C2)S(=O)(=O)N4CCC5(CC4)OCCO5)CCC(=O)N3C1 |
Product Overview
CID7384618 (CAS 896357-09-8), with molecular formula C19H24N2O5S and molecular weight 392.1406 g/mol. IUPAC: 7-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.