HMS3523G17
N-[(4-chlorophenyl)methyl]-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-sulfonamide
Also Known As: NCGC00274635-01|AB01277337-01|BRD-K74312058-001-01-4|F2669-0015|N-[(4-chlorophenyl)methyl]-2-oxo-1-azatricyclo[7.3.1.0^{5,13}]trideca-5,7,9(13)-triene-7-sulfonamide|N-(4-chlorobenzyl)-3-oxo-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline-9-sulfonamide|N-(4-chlorobenzyl)-3-oxo-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinoline-9-sulfonamide|N-[(4-chlorophenyl)methyl]-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-sulfonamide
| Molecular Formula | C19H19ClN2O3S |
|---|---|
| Molecular Weight | 390.0805 g/mol |
| LogP | 3.0439 |
| Topological Polar Surface Area | 66.48 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 390.0805 |
| Monoisotopic Mass | 390.0805 |
| Heavy Atoms | 26 |
| Complexity | 953.7739 |
Chemical Identifiers
| CAS Number | 896375-49-8 |
|---|---|
| SMILES | C1CC2=C3C(=CC(=C2)S(=O)(=O)NCC4=CC=C(C=C4)Cl)CCC(=O)N3C1 |
Product Overview
HMS3523G17 (CAS 896375-49-8), with molecular formula C19H19ClN2O3S and molecular weight 390.0805 g/mol. IUPAC: N-[(4-chlorophenyl)methyl]-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-7-sulfonamide.