AC1LYCV8
N-(2,6-dibromo-4-methylphenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide
Also Known As: N-(2,6-dibromo-4-methylphenyl)-2-{[5-(4-fluorophenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide|2-((4-allyl-5-(4-fluorophenyl)-4H-1,2,4-triazol-3-yl)thio)-N-(2,6-dibromo-4-methylphenyl)acetamide|N-(2,6-dibromo-4-methylphenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide|N-(2,6-dibromo-4-methylphenyl)-2-[5-(4-fluorophenyl)-4-prop-2-enyl(1,2,4-triaz ol-3-ylthio)]acetamide
| Molecular Formula | C20H17Br2FN4OS |
|---|---|
| Molecular Weight | 537.9474 g/mol |
| LogP | 5.83442 |
| Topological Polar Surface Area | 59.81 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 537.9474 |
| Monoisotopic Mass | 539.9453 |
| Heavy Atoms | 29 |
| Complexity | 1030.1299 |
Chemical Identifiers
| CAS Number | 896830-37-8 |
|---|---|
| SMILES | CC1=CC(=C(C(=C1)Br)NC(=O)CSC2=NN=C(N2CC=C)C3=CC=C(C=C3)F)Br |
Product Overview
AC1LYCV8 (CAS 896830-37-8), with molecular formula C20H17Br2FN4OS and molecular weight 537.9474 g/mol. IUPAC: N-(2,6-dibromo-4-methylphenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.