![2-Naphthalenamine, N-[(4-nitrophenyl)methylene]- structure](/static/products/898/898-03-3.png)
2-Naphthalenamine, N-[(4-nitrophenyl)methylene]-
N-naphthalen-2-yl-1-(4-nitrophenyl)methanimine
Also Known As: 2-Naphthalenamine, N-[(4-nitrophenyl)methylene]-|p-nitrobenzylidene-2-naphthylamine|N-naphthalen-2-yl-1-(4-nitrophenyl)methanimine|BAS 00076777|Naphthalen-2-yl-(4-nitro-benzylidene)-amine|(1E)-1-(2-naphthyl)-2-(4-nitrophenyl)-1-azaethene|N-[(E)-(4-nitrophenyl)methylidene]-2-naphthalenamine|(E)-N-(Naphthalen-2-yl)-1-(4-nitrophenyl)methanimine
| Molecular Formula | C17H12N2O2 |
|---|---|
| Molecular Weight | 276.08987 g/mol |
| LogP | 4.4986 |
| Topological Polar Surface Area | 55.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 276.08987 |
| Monoisotopic Mass | 276.08987 |
| Heavy Atoms | 21 |
| Complexity | 823.57263 |
Chemical Identifiers
| CAS Number | 898-03-3 |
|---|---|
| SMILES | C1=CC=C2C=C(C=CC2=C1)N=CC3=CC=C(C=C3)[N+](=O)[O-] |
Product Overview
2-Naphthalenamine, N-[(4-nitrophenyl)methylene]- (CAS 898-03-3), with molecular formula C17H12N2O2 and molecular weight 276.08987 g/mol. IUPAC: N-naphthalen-2-yl-1-(4-nitrophenyl)methanimine.
2-Naphthalenamine, N-[(4-nitrophenyl)methylene]- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »