Methyl 4-(2-methylphenyl)benzoate
methyl 4-(2-methylphenyl)benzoate
Also Known As: Methyl 4-(2-methylphenyl)benzoate|ACMC-20lrru|methyl 2'-methyl-[1,1'-biphenyl]-4-carboxylate|methyl 4-(o-tolyl)benzoate|2'-methyl-[1,1'-biphenyl]-4-carboxylic acid methyl ester|4-(2-methylphenyl)benzoic acid methyl ester|methyl 2'-methyl[1,1'-biphenyl]-4-carboxylate|4-methyloxycarbonyl-2'-methyl-1,1'-biphenyl|BB 0222624|J1.527.438G|2'-Methylbiphenyl-4-carboxylic acid methyl ester|[1,1'-Biphenyl]-4-carboxylicacid, 2'-methyl-, methyl ester|2'-methyl biphenyl-4-carboxylic acid methyl ester|2 -Methylbiphenyl-4-carboxylic acid methyl ester|2-Methylbiphenyl-4 -carboxylic acid methyl ester|[1,1'-BIPHENYL]-4-CARBOXYLIC ACID,2'-METHYL-,METHY
| Molecular Formula | C15H14O2 |
|---|---|
| Molecular Weight | 226.09938 g/mol |
| LogP | 3.44862 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 226.09938 |
| Monoisotopic Mass | 226.09938 |
| Heavy Atoms | 17 |
| Complexity | 526.873 |
Chemical Identifiers
| CAS Number | 89900-99-2 |
|---|---|
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)C(=O)OC |
Product Overview
Methyl 4-(2-methylphenyl)benzoate (CAS 89900-99-2), with molecular formula C15H14O2 and molecular weight 226.09938 g/mol. IUPAC: methyl 4-(2-methylphenyl)benzoate.