AC1LZQH0
2-[[4-(4-methoxyphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide
Also Known As: 2-{[4-(4-methoxyphenyl)-5-(thiophen-2-ylmethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(4-sulfamoylphenyl)acetamide|2-((4-(4-methoxyphenyl)-5-(thiophen-2-ylmethyl)-4H-1,2,4-triazol-3-yl)thio)-N-(4-sulfamoylphenyl)acetamide|2-[[4-(4-methoxyphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide|2-[4-(4-methoxyphenyl)-5-(2-thienylmethyl)(1,2,4-triazol-3-ylthio)]-N-(4-sulfa moylphenyl)acetamide
| Molecular Formula | C22H21N5O4S3 |
|---|---|
| Molecular Weight | 515.07556 g/mol |
| LogP | 3.3064 |
| Topological Polar Surface Area | 129.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Exact Mass | 515.07556 |
| Monoisotopic Mass | 515.07556 |
| Heavy Atoms | 34 |
| Complexity | 1367.1831 |
Chemical Identifiers
| CAS Number | 899409-05-3 |
|---|---|
| SMILES | COC1=CC=C(C=C1)N2C(=NN=C2SCC(=O)NC3=CC=C(C=C3)S(=O)(=O)N)CC4=CC=CS4 |
Product Overview
AC1LZQH0 (CAS 899409-05-3), with molecular formula C22H21N5O4S3 and molecular weight 515.07556 g/mol. IUPAC: 2-[[4-(4-methoxyphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide.