Methyl 3-methylflavone-8-carboxylate
methyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate
Also Known As: Flavoxate related compound B|O-Desethylpiperidine Flavoxate Methyl Ester|methyl 3-methylflavone-8-carboxylate|Flavoxate related compound B [USP]|3-Methylflavone-8-carboxylic acid methyl ester|Flavoxate Hydrochloride USP RC B|methyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate|Flavoxate related compound B (USP)|FLAVOXATE RELATED COMPOUND B [USP-RS]|methyl 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylate|FLAVOXATE RELATED COMPOUND B (USP-RS)|FLAVOXATE RELATED COMPOUND B [USP IMPURITY]|AA-504/08377034|4H-1-Benzopyran-8-carboxylic acid, 3-methyl-4-oxo-2-phenyl-, methyl ester|FLAVOXATE RELATED COMPOUND B (USP IMPURITY)|4h-1-benzopyran-8-carboxylic acid,3-methyl-4-oxo-2-phenyl-,methyl ester|Methyl 3-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate|3-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylic acid methyl ester|Flavoxate Related Compound B (20 mg) (3-Methylflavone-8-carboxylic acid methyl ester)|Methyl 3-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate; 3-Methyl-flavone-8-carboxylic Acid Methyl Ester
| Molecular Formula | C18H14O4 |
|---|---|
| Molecular Weight | 294.0892 g/mol |
| LogP | 3.55502 |
| Topological Polar Surface Area | 56.51 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 294.0892 |
| Monoisotopic Mass | 294.0892 |
| Heavy Atoms | 22 |
| Complexity | 907.5136 |
Chemical Identifiers
| CAS Number | 90101-87-4 |
|---|---|
| SMILES | CC1=C(OC2=C(C1=O)C=CC=C2C(=O)OC)C3=CC=CC=C3 |
Product Overview
Methyl 3-methylflavone-8-carboxylate (CAS 90101-87-4), with molecular formula C18H14O4 and molecular weight 294.0892 g/mol. IUPAC: methyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
Methyl 3-methylflavone-8-carboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »