(2,3-Dihydro-1H-indol-1-yl)(4-fluorophenyl)methanone
2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone
Also Known As: - -METHANONE|CBMicro_024882|(4-Fluorophenyl)(indolin-1-yl)methanone|4-fluorophenyl indolinyl ketone|(2,3-DIHYDROINDOL-1-YL)-(4-FLUOROPHENYL)-METHANONE|2-(2-chlorophenyl)ethanethioamide|2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone|1-(4-fluorobenzoyl)-2,3-dihydro-1H-indole|BIM-0024723.P001|2,3-dihydro-1H-indol-1-yl(4-fluorophenyl)methanone|AB00089026-01|(2,3-Dihydro-1H-indol-1-yl)(4-fluorophenyl)methanone|(2,3-dihydroindol-1-yl)(4-fluorophenyl)methanone|(2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone|SR-01000482828-1
| Molecular Formula | C15H12FNO |
|---|---|
| Molecular Weight | 241.09029 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 20.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 241.09029 |
| Monoisotopic Mass | 241.09029 |
| Heavy Atoms | 18 |
| Complexity | 312.0 |
Chemical Identifiers
| CAS Number | 90172-60-4 |
|---|---|
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C3=CC=C(C=C3)F |
| InChIKey | FZMVZJOCYNSJOF-UHFFFAOYSA-N |
Product Overview
(2,3-Dihydro-1H-indol-1-yl)(4-fluorophenyl)methanone (CAS 90172-60-4), with molecular formula C15H12FNO and molecular weight 241.09029 g/mol. IUPAC: 2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone.
(2,3-Dihydro-1H-indol-1-yl)(4-fluorophenyl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »