![Ethanone, 1-[4-(diethylamino)phenyl]-2-phenyl- structure](/static/products/905/90547-65-2.png)
Ethanone, 1-[4-(diethylamino)phenyl]-2-phenyl-
1-[4-(diethylamino)phenyl]-2-phenylethanone
Also Known As: ACMC-20lt33|4'-Diethylamino-2-phenylacetophenone|Ethanone, 1-[4-(diethylamino)phenyl]-2-phenyl-|1-[4-(diethylamino)phenyl]-2-phenylethanone|1-(4-diethylaminophenyl)-2-phenyl-ethanone|1-(4-(Diethylamino)phenyl)-2-phenylethanone|1-[4-(diethylamino)phenyl]-2-phenyl-ethanone|Ethanone,1-[4-(diethylamino)phenyl]-2-phenyl|1-[4-(Diethylamino)phenyl]-2-phenylethan-1-one
| Molecular Formula | C18H21NO |
|---|---|
| Molecular Weight | 267.16232 g/mol |
| LogP | 3.9582 |
| Topological Polar Surface Area | 20.31 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 267.16232 |
| Monoisotopic Mass | 267.16232 |
| Heavy Atoms | 20 |
| Complexity | 541.39075 |
Chemical Identifiers
| CAS Number | 90547-65-2 |
|---|---|
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)CC2=CC=CC=C2 |
Product Overview
Ethanone, 1-[4-(diethylamino)phenyl]-2-phenyl- (CAS 90547-65-2), with molecular formula C18H21NO and molecular weight 267.16232 g/mol. IUPAC: 1-[4-(diethylamino)phenyl]-2-phenylethanone.
Ethanone, 1-[4-(diethylamino)phenyl]-2-phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »