Benzamide, 2,6-difluoro-N-(((4-methoxyphenyl)amino)carbonyl)-
2,6-difluoro-N-[(4-methoxyphenyl)carbamoyl]benzamide
Also Known As: 2,6-difluoro-N-[(4-methoxyphenyl)carbamoyl]benzamide|1-(2,6-difluorobenzoyl)-3-(4-methoxyphenyl)urea|1-(2,6-Difluorobenzoyl)-3-[4-methoxyphenyl]urea|Benzamide, 2,6-difluoro-N-(((4-methoxyphenyl)amino)carbonyl)-|2,6-Difluoro-N-[(4-methoxyphenyl)carbamoyl]benzene-1-carboximidic acid
| Molecular Formula | C15H12F2N2O3 |
|---|---|
| Molecular Weight | 306.0816 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 67.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 306.0816 |
| Monoisotopic Mass | 306.0816 |
| Heavy Atoms | 22 |
| Complexity | 390.0 |
Chemical Identifiers
| CAS Number | 90593-80-9 |
|---|---|
| SMILES | COC1=CC=C(C=C1)NC(=O)NC(=O)C2=C(C=CC=C2F)F |
| InChIKey | NWLLPNGCEIPLKB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzamide, 2,6-difluoro-N-(((4-methoxyphenyl)amino)carbonyl)- (CAS 90593-80-9), with molecular formula C15H12F2N2O3 and molecular weight 306.0816 g/mol. IUPAC: 2,6-difluoro-N-[(4-methoxyphenyl)carbamoyl]benzamide.
Benzamide, 2,6-difluoro-N-(((4-methoxyphenyl)amino)carbonyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »