Ethenyl acetate;2-ethylhexyl prop-2-enoate
ethenyl acetate;2-ethylhexyl prop-2-enoate
Also Known As: Acrylates/VA copolymer|Vinyl acetate/acrylate copolymer|ACRYLATES / VA COPOLYMER|Vinyl acetate, 2-ethylhexyl acrylate polymer|Poly(vinyl acetate-2-ethylhexyl acrylate)|ethenyl acetate;2-ethylhexyl prop-2-enoate|2-ethylhexyl prop-2-enoate; vinyl acetate|(C11-H20-O2.C4-H6-O2)x-|2-Propenoic acid, 2-ethylhexyl ester, polymer with ethenyl acetate|ethenyl acetate; 2-ethylhexyl prop-2-enoate|2-ethylhexyl prop-2-enoate- ethenyl acetate(1:1)|Ethenyl acetate--2-ethylhexyl prop-2-enoate (1/1)
| Molecular Formula | C15H26O4 |
|---|---|
| Molecular Weight | 270.1831 g/mol |
| LogP | 3.625 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Exact Mass | 270.1831 |
| Monoisotopic Mass | 270.1831 |
| Heavy Atoms | 19 |
| Complexity | 218.0 |
Chemical Identifiers
| CAS Number | 9060-83-7 |
|---|---|
| SMILES | CCCCC(CC)COC(=O)C=C.CC(=O)OC=C |
| InChIKey | RAEGHCPKKXGGQN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethenyl acetate;2-ethylhexyl prop-2-enoate (CAS 9060-83-7), with molecular formula C15H26O4 and molecular weight 270.1831 g/mol. IUPAC: ethenyl acetate;2-ethylhexyl prop-2-enoate.