Ethyl 4-chloro-2,6-dimethylnicotinate
ethyl 4-chloro-2,6-dimethylpyridine-3-carboxylate
Also Known As: ethyl 4-chloro-2,6-dimethylnicotinate|Mariptiline|ethyl 4-chloro-2,6-dimethylpyridine-3-carboxylate|Ethyl4-chloro-2,6-dimethylnicotinate|4-chloro-2,6-dimethylnicotinic acid ethylate|ethyl4-chloro-2,6-dimethyl-pyridine-3-carboxylate|4-Chlor-2,6-dimethyl-3-pyridincarbonsaeure-ethylester|ETHYL 4-CHLORO-2,6-DIMETHYL-PYRIDINE-3-CARBOXYLATE|3-Pyridinecarboxylicacid, 4-chloro-2,6-dimethyl-, ethyl ester|Ethyl 4-chloro-2,6-dimethylpyridine-3-carboxylate, 97% - 1G 1g
| Molecular Formula | C10H12ClNO2 |
|---|---|
| Molecular Weight | 213.05565 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 39.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 213.05565 |
| Monoisotopic Mass | 213.05565 |
| Heavy Atoms | 14 |
| Complexity | 210.0 |
Chemical Identifiers
| CAS Number | 90646-72-3 |
|---|---|
| SMILES | CCOC(=O)C1=C(C=C(N=C1C)C)Cl |
| InChIKey | KBTAWKCADOMPGE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 4-chloro-2,6-dimethylnicotinate (CAS 90646-72-3), with molecular formula C10H12ClNO2 and molecular weight 213.05565 g/mol. IUPAC: ethyl 4-chloro-2,6-dimethylpyridine-3-carboxylate.