[10-[4-(4-Methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenyl-methanone
[10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenylmethanone
Also Known As: NCI60_027653|J3.806.597A|2-benzoyl-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine|2-benzoyl-10-[4-(4-methylpiperazin-1-yl)butyl]-10H-phenothiazine|[10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenyl-methanone|[10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenylmethanone|(10-(4-(4-Methyl-1-piperazinyl)butyl)-10H-phenothiazin-2-yl)(phenyl)methanone oxalate|(10-(4-(4-methylpiperazin-1-yl)butyl)-10H-phenothiazin-2-yl)(phenyl)methanone
| Molecular Formula | C28H31N3OS |
|---|---|
| Molecular Weight | 457.21878 g/mol |
| LogP | 6.2 |
| Topological Polar Surface Area | 52.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 457.21878 |
| Monoisotopic Mass | 457.21878 |
| Heavy Atoms | 33 |
| Complexity | 631.0 |
Chemical Identifiers
| CAS Number | 907547-06-2 |
|---|---|
| SMILES | CN1CCN(CC1)CCCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(=O)C5=CC=CC=C5 |
| InChIKey | YVRLVNJCHMOEHI-UHFFFAOYSA-N |
Product Overview
[10-[4-(4-Methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenyl-methanone (CAS 907547-06-2), with molecular formula C28H31N3OS and molecular weight 457.21878 g/mol. IUPAC: [10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenylmethanone.
[10-[4-(4-Methylpiperazin-1-yl)butyl]phenothiazin-2-yl]-phenyl-methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »