2-(6-Aminopurin-9-yl)ethanol
2-(6-aminopurin-9-yl)ethanol
Also Known As: 2-(6-aminopurin-9-yl)ethanol|9-(2-Hydroxyethyl)adenine|Unknown Ligand|2- ethanol|9-(2-hydroxyethyl) adenine|9h-purine-9-ethanol, 6-amino-|N9 -hydroxyethyladenine|6-Bromo-5-methylindole|6-Amino-9H-purin-9-ethanol|9-(2hydroxyethyl)adenine|ACMC-209og5|TimTec1_003634|2-(6-amino-9H-purin-9-yl)ethan-1-ol|9-(2'-hydroxyethyl)adenine|9-(2-Hydroxyethyl)adenine.|9-(2-Hydroxyethyl)-9H-adenine|6-Amino-9h-purine-9-ethanol|6-Amino-9-(2-hydroxyethyl)purine|KS-00000VZR|2-(6-amino-purin-9-yl)ethanol|Tenofovir disoproxil Impurity 85|2-(6-Amino-purin-9-yl)-ethanol|2-(6-aminopurin-9-yl)ethan-1-ol|6-amino-9-(2-hydroxyethyl)-9h-purine|0981AC|CH-659
| Molecular Formula | C7H9N5O |
|---|---|
| Molecular Weight | 179.0807 g/mol |
| LogP | -0.8 |
| Topological Polar Surface Area | 89.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 179.0807 |
| Monoisotopic Mass | 179.0807 |
| Heavy Atoms | 13 |
| Complexity | 178.0 |
Chemical Identifiers
| CAS Number | 91052-96-9 |
|---|---|
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CCO)N |
| InChIKey | VAQOTZQDXZDBJK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(6-Aminopurin-9-yl)ethanol (CAS 91052-96-9), with molecular formula C7H9N5O and molecular weight 179.0807 g/mol. IUPAC: 2-(6-aminopurin-9-yl)ethanol.