![5,6-Dibromo-3-(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid structure](/static/products/910/91064-37-8.png)
5,6-Dibromo-3-(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid
5,6-dibromo-3-methoxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid
Also Known As: 5,6-dibromo-3-(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid|5,6-dibromo-3-methoxycarbonyl-norbornane-2-carboxylic acid|2,3-dibromo-5-methoxycarbonylbicyclo[2.2.1]heptane-6-carboxy|2,3-dibromo-5-methoxycarbonylbicyclo[2.2.1]heptane-6-carboxylic acid
| Molecular Formula | C10H12Br2O4 |
|---|---|
| Molecular Weight | 353.91022 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 63.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 353.91022 |
| Monoisotopic Mass | 353.91022 |
| Heavy Atoms | 16 |
| Complexity | 333.0 |
Chemical Identifiers
| CAS Number | 91064-37-8 |
|---|---|
| SMILES | COC(=O)C1C2CC(C1C(=O)O)C(C2Br)Br |
| InChIKey | CEKJTNRDLCMPHH-UHFFFAOYSA-N |
Product Overview
5,6-Dibromo-3-(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 91064-37-8), with molecular formula C10H12Br2O4 and molecular weight 353.91022 g/mol. IUPAC: 5,6-dibromo-3-methoxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid.
5,6-Dibromo-3-(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »