Ethyl 3-amino-5-{[1,1'-biphenyl]-4-yl}thiophene-2-carboxylate
ethyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate
Also Known As: ethyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate|ethyl 3-amino-5-(1,1'-biphenyl-4-yl)thiophene-2-carboxylate|ethyl 3-amino-5-{[1,1'-biphenyl]-4-yl}thiophene-2-carboxylate|ETHYL3-AMINO-5- THIOPHENE-2-CARBOXYLATE|Ethyl5-([1,1'-biphenyl]-4-yl)-3-aminothiophene-2-carboxylate|ethyl 3-amino-5-((1,1'-biphenyl)-4-yl)thiophene-2-carboxylate|Ethyl 3-amino-5-([1,1'-biphenyl]-4-yl)thiophene-2-carboxylate|Ethyl 5-([1,1'-biphenyl]-4-yl)-3-aminothiophene-2-carboxylate|100-337-4
| Molecular Formula | C19H17NO2S |
|---|---|
| Molecular Weight | 323.098 g/mol |
| LogP | 4.841 |
| Topological Polar Surface Area | 52.32 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 323.098 |
| Monoisotopic Mass | 323.098 |
| Heavy Atoms | 23 |
| Complexity | 807.1458 |
Chemical Identifiers
| CAS Number | 91076-98-1 |
|---|---|
| SMILES | CCOC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)C3=CC=CC=C3)N |
Product Overview
Ethyl 3-amino-5-{[1,1'-biphenyl]-4-yl}thiophene-2-carboxylate (CAS 91076-98-1), with molecular formula C19H17NO2S and molecular weight 323.098 g/mol. IUPAC: ethyl 3-amino-5-(4-phenylphenyl)thiophene-2-carboxylate.