(2S)-2-(((benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid
Also Known As: Z-Asp(OMe)-OH|Cbz-Asp(OMe)-OH|Cbz-Asp(OMe)OH|N-CBZ-L-Aspartate|Z-ASP -OH|(S)-2-N-Cbz-amino-succinic acid 4-methyl ester|Boc-D-alanine methyl ester|Cbz-L-aspartic acid 4-methyl ester|Z-L-Aspartic acid 4-methyl ester|KS-00000J9O|Z-L-aspartic acid beta-methyl ester|CZ-030|CS-W012269|HY-W011553|N-Cbz-L-aspartic acid |A-methyl ester|Z-Asp(OMe)-OH, 98% - 5G 5g|N-Benzyloxycarbonyl-L-aspartic acid 4-methyl ester|Z-Asp(OMe)-OH, >=98.0% (TLC)|(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid|(S)-2-(((Benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
| Molecular Formula | C13H15NO6 |
|---|---|
| Molecular Weight | 281.08994 g/mol |
| LogP | 0.9291 |
| Topological Polar Surface Area | 101.93 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 281.08994 |
| Monoisotopic Mass | 281.08994 |
| Heavy Atoms | 20 |
| Complexity | 473.00955 |
Chemical Identifiers
| CAS Number | 91103-47-8 |
|---|---|
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Product Overview
(2S)-2-(((benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid (CAS 91103-47-8), with molecular formula C13H15NO6 and molecular weight 281.08994 g/mol. IUPAC: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid.
(2S)-2-(((benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »