![N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide structure](/static/products/916/91687-65-9.png)
N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide
N-[1-(4-bromophenyl)ethyl]-2-chloroacetamide
Also Known As: N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide|N-(1-(4-Bromophenyl)ethyl)-2-chloroacetamide|N-[1- ETHYL]-2-CHLOROACETAMIDE|NCGC00661473-01|Acetamide, N-[1-(4-bromophenyl)ethyl]-2-chloro-|N-[(4-bromophenyl)ethyl]-2-chloroacetamide|N-1-(4-Bromophenyl)ethyl-2-chloroacetamide|N-[1-(4-bromophenyl)ethyl]-2-chloro-acetamide|N-[1-(4-bromo-phenyl)-ethyl]-2-chloro-acetamide|N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide #
| Molecular Formula | C10H11BrClNO |
|---|---|
| Molecular Weight | 274.97125 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 29.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 274.97125 |
| Monoisotopic Mass | 274.97125 |
| Heavy Atoms | 14 |
| Complexity | 193.0 |
Chemical Identifiers
| CAS Number | 91687-65-9 |
|---|---|
| SMILES | CC(C1=CC=C(C=C1)Br)NC(=O)CCl |
| InChIKey | QOVVMRZOAXDWMK-UHFFFAOYSA-N |
Product Overview
N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide (CAS 91687-65-9), with molecular formula C10H11BrClNO and molecular weight 274.97125 g/mol. IUPAC: N-[1-(4-bromophenyl)ethyl]-2-chloroacetamide.
N-[1-(4-Bromophenyl)ethyl]-2-chloroacetamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »