3-(Methoxycarbonyl)amino-beta-carboline
methyl N-(9H-pyrido[3,4-b]indol-3-yl)carbamate
Also Known As: 3-Mcabc|beta-CMC|3-(Methoxycarbonyl)amino-beta-carboline|3- amino-beta-carboline|methyl N-(9H-pyrido[3,4-b]indol-3-yl)carbamate|3-[(methoxycarbonyl)amino]-beta-carboline|methyl 9H-pyrido[3,4-b]indol-3-ylcarbamate|(beta-Carboline-3-yl)carbamic acid methyl ester|[9H-Pyrido[3,4-b]indol-3-yl]carbamic acid methyl ester|Methyl hydrogen 9H-pyrido[3,4-b]indol-3-ylcarbonimidate|METHYL N-{9H-PYRIDO[3,4-B]INDOL-3-YL}CARBAMATE|Carbamic acid, 9H-pyrido(3,4-b)indol-3-yl-, methyl ester
| Molecular Formula | C13H11N3O2 |
|---|---|
| Molecular Weight | 241.08513 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 67.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 241.08513 |
| Monoisotopic Mass | 241.08513 |
| Heavy Atoms | 18 |
| Complexity | 323.0 |
Chemical Identifiers
| CAS Number | 91985-74-9 |
|---|---|
| SMILES | COC(=O)NC1=NC=C2C(=C1)C3=CC=CC=C3N2 |
| InChIKey | WCNHWQATGLIDEY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-(Methoxycarbonyl)amino-beta-carboline (CAS 91985-74-9), with molecular formula C13H11N3O2 and molecular weight 241.08513 g/mol. IUPAC: methyl N-(9H-pyrido[3,4-b]indol-3-yl)carbamate.