![{5-[Bis(2-chloroethyl)amino]-1H-indol-3-yl}acetic acid structure](/static/products/922/92298-15-2.png)
{5-[Bis(2-chloroethyl)amino]-1H-indol-3-yl}acetic acid
2-[5-[bis(2-chloroethyl)amino]-1H-indol-3-yl]acetic acid
Also Known As: 2-[5-[bis amino]-1H-indol-3-yl]aceticacid|2-[5-[bis(2-chloroethyl)amino]-1H-indol-3-yl]acetic acid|{5-[Bis(2-chloroethyl)amino]-1H-indol-3-yl}acetic acid|Indole-3-acetic acid, 5-[bis(2-chloroethyl)amino]-|1H-Indole-3-acetic acid, 5-[bis(2-chloroethyl)amino]-|1H-Indole-3-aceticacid, 5-[bis(2-chloroethyl)amino]-|2-{[Bis-(2-cyano-aethyl)-amino]-methyl}-4-chlor-6-methyl-phenol
| Molecular Formula | C14H16Cl2N2O2 |
|---|---|
| Molecular Weight | 314.05887 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 56.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Exact Mass | 314.05887 |
| Monoisotopic Mass | 314.05887 |
| Heavy Atoms | 20 |
| Complexity | 324.0 |
Chemical Identifiers
| CAS Number | 92298-15-2 |
|---|---|
| SMILES | C1=CC2=C(C=C1N(CCCl)CCCl)C(=CN2)CC(=O)O |
| InChIKey | XEXPXBJRHZAJJI-UHFFFAOYSA-N |
Product Overview
{5-[Bis(2-chloroethyl)amino]-1H-indol-3-yl}acetic acid (CAS 92298-15-2), with molecular formula C14H16Cl2N2O2 and molecular weight 314.05887 g/mol. IUPAC: 2-[5-[bis(2-chloroethyl)amino]-1H-indol-3-yl]acetic acid.
{5-[Bis(2-chloroethyl)amino]-1H-indol-3-yl}acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »