![S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)cysteine structure](/static/products/9245/92452-75-0.webp)
S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)cysteine
(2R)-2-acetamido-3-[[tert-butyl(nitroso)amino]methylsulfanyl]propanoic acid
Also Known As: FR 900411|S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)cysteine|(2R)-2-acetamido-3-[[tert-butyl(nitroso)amino]methylsulfanyl]propanoic acid|(2R)-2-Acetamido-3-9(tert-butyl-nitrosoamino)methylsulfanyl)propanoic acid|S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)-L-cysteine
| Molecular Formula | C10H19N3O4S |
|---|---|
| Molecular Weight | 277.10962 g/mol |
| LogP | 0.9 |
| Topological Polar Surface Area | 124.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Exact Mass | 277.10962 |
| Monoisotopic Mass | 277.10962 |
| Heavy Atoms | 18 |
| Complexity | 317.0 |
Chemical Identifiers
| CAS Number | 92452-75-0 |
|---|---|
| SMILES | CC(=O)N[C@@H](CSCN(C(C)(C)C)N=O)C(=O)O |
| InChIKey | ABZRGCPWCBDYAR-QMMMGPOBSA-N |
Product Overview
S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)cysteine (CAS 92452-75-0), with molecular formula C10H19N3O4S and molecular weight 277.10962 g/mol. IUPAC: (2R)-2-acetamido-3-[[tert-butyl(nitroso)amino]methylsulfanyl]propanoic acid.
S-{[tert-Butyl(nitroso)amino]methyl}-N-(1-hydroxyethylidene)cysteine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »