5,6-Dichloro-2-naphthalen-1-ylisoindole-1,3-dione
5,6-dichloro-2-naphthalen-1-ylisoindole-1,3-dione
Also Known As: BAS 00391100|5,6-dichloro-2-naphthalen-1-ylisoindole-1,3-dione|5,6-dichloro-2-(naphthalen-1-yl)-2,3-dihydro-1H-isoindole-1,3-dione|5,6-dichloro-2-(naphthalen-1-yl)isoindoline-1,3-dione|5,6-dichloro-2-naphthylbenzo[c]azoline-1,3-dione|SR-01000398149-1|5,6-Dichloro-2-naphthalen-1-yl-isoindole-1,3-dione|F0722-1147|A1198/0055183
| Molecular Formula | C18H9Cl2NO2 |
|---|---|
| Molecular Weight | 341.00104 g/mol |
| LogP | 5.0 |
| Topological Polar Surface Area | 37.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 341.00104 |
| Monoisotopic Mass | 341.00104 |
| Heavy Atoms | 23 |
| Complexity | 483.0 |
Chemical Identifiers
| CAS Number | 93296-70-9 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=O)C4=CC(=C(C=C4C3=O)Cl)Cl |
| InChIKey | VSGJRUNPBFMMHD-UHFFFAOYSA-N |
Product Overview
5,6-Dichloro-2-naphthalen-1-ylisoindole-1,3-dione (CAS 93296-70-9), with molecular formula C18H9Cl2NO2 and molecular weight 341.00104 g/mol. IUPAC: 5,6-dichloro-2-naphthalen-1-ylisoindole-1,3-dione.
5,6-Dichloro-2-naphthalen-1-ylisoindole-1,3-dione is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »