Stannane, trimethyl(3-methylphenyl)-
trimethyl-(3-methylphenyl)stannane
Also Known As: m-Tolyltrimethylstannane|m-Tolyltrimethyltin|trimethyl(m-tolyl)stannane|Stannane, trimethyl-m-tolyl-|m-Tolyltrimethyltin(IV)|Trimethyl-m-tolylstannane|m-Methylphenyltrimethyltin|Stannane, trimethyl(3-methylphenyl)-|5-(trimethylstannyl)toluene|Trimethyl(3-methylphenyl)stannane|m-Methylphenyltrimethyltin(IV)|trimethyl-(3-methylphenyl)stannane|(3-Methylphenyl)trimethylstannane|Trimethyl(3-methylphenyl)stannane #
| Molecular Formula | C10H16Sn |
|---|---|
| Molecular Weight | 256.0274 g/mol |
| LogP | 2.54022 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 1 |
| Exact Mass | 256.0274 |
| Monoisotopic Mass | 256.0274 |
| Heavy Atoms | 11 |
| Complexity | 123.0 |
Chemical Identifiers
| CAS Number | 937-01-9 |
|---|---|
| SMILES | CC1=CC(=CC=C1)[Sn](C)(C)C |
| InChIKey | KWGXEOLVIDRMDD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Stannane, trimethyl(3-methylphenyl)- (CAS 937-01-9), with molecular formula C10H16Sn and molecular weight 256.0274 g/mol. IUPAC: trimethyl-(3-methylphenyl)stannane.
Stannane, trimethyl(3-methylphenyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »