![(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid structure](/static/products/937/93709-67-2.png)
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid
Also Known As: (2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid|CBDivE_013818|3-fluorobenzene-1,2-diamine|-2-[ AMINO]PROPANOICACID|N-(3,4,5-trimethoxybenzoyl)alanine|L-Alanine,N-(3,4,5-trimethoxybenzoyl)-|(2S)-2-[(3,4,5-trimethoxyphenyl)formamido]propanoic acid|L-Alanine, N-(3,4,5-trimethoxybenzoyl)-|(S)-2-(3,4,5-Trimethoxybenzamido)propanoic acid|A1-00738
| Molecular Formula | C13H17NO6 |
|---|---|
| Molecular Weight | 283.1056 g/mol |
| LogP | 1.1 |
| Topological Polar Surface Area | 94.1 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 283.1056 |
| Monoisotopic Mass | 283.1056 |
| Heavy Atoms | 20 |
| Complexity | 334.0 |
Chemical Identifiers
| CAS Number | 93709-67-2 |
|---|---|
| SMILES | C[C@@H](C(=O)O)NC(=O)C1=CC(=C(C(=C1)OC)OC)OC |
| InChIKey | LYDVPBQLBMIUQN-ZETCQYMHSA-N |
Product Overview
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid (CAS 93709-67-2), with molecular formula C13H17NO6 and molecular weight 283.1056 g/mol. IUPAC: (2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid.
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »