Lanceotoxin B
[10-formyl-14-hydroxy-13-methyl-17-(6-oxopyran-3-yl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-yl] acetate
Also Known As: Lanceotoxin B|[10-formyl-14-hydroxy-13-methyl-17-(6-oxopyran-3-yl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-yl] acetate
| Molecular Formula | C32H44O11 |
|---|---|
| Molecular Weight | 604.2884 g/mol |
| LogP | -0.1 |
| Topological Polar Surface Area | 169.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Exact Mass | 604.2884 |
| Monoisotopic Mass | 604.2884 |
| Heavy Atoms | 43 |
| Complexity | 1220.0 |
Chemical Identifiers
| CAS Number | 93802-98-3 |
|---|---|
| SMILES | CC1C(C(C(C(O1)OC2CCC3(C4CCC5(C(CCC5(C4CCC3(C2)OC(=O)C)O)C6=COC(=O)C=C6)C)C=O)O)O)O |
| InChIKey | IKNIMVNUBXHADS-UHFFFAOYSA-N |
Product Overview
Lanceotoxin B (CAS 93802-98-3), with molecular formula C32H44O11 and molecular weight 604.2884 g/mol. IUPAC: [10-formyl-14-hydroxy-13-methyl-17-(6-oxopyran-3-yl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-5-yl] acetate.
Lanceotoxin B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »