4-Nitrophenyl chloromethyl(phenyl)phosphinate
1-[chloromethyl(phenyl)phosphoryl]oxy-4-nitrobenzene
Also Known As: TA 009|4-Nitrophenyl chloromethyl(phenyl)phosphinate|(Chloromethyl)phenylphosphinic acid p-nitrophenyl ester|4-nitrophenyl(chloromethyl)phenylphosphinate|4-Nitrophenyl monochloromethyl phenylphosphinate|4-nitrophenyl (chloromethyl)(phenyl)phosphinate|(Chloromethyl)phenylphosphinic acid 4-nitrophenyl ester|4-Nitrophenyl (chloromethyl)phenylphosphinate|1-[chloromethyl(phenyl)phosphoryl]oxy-4-nitrobenzene|Phosphinic acid, (chloromethyl)phenyl-, 4-nitrophenyl ester|Phosphinic acid, (chloromethyl)phenyl-, p-nitrophenyl ester|Phosphonic acid, (chloromethyl)phenyl-, 4-nitrophenyl ester|Chloromethyl(phenyl)phosphinic acid 4-nitrophenyl ester|Phosphinic acid,(chloromethyl)phenyl-, 4-nitrophenyl ester (9CI)
| Molecular Formula | C13H11ClNO4P |
|---|---|
| Molecular Weight | 311.0114 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 72.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 311.0114 |
| Monoisotopic Mass | 311.0114 |
| Heavy Atoms | 20 |
| Complexity | 373.0 |
Chemical Identifiers
| CAS Number | 940-93-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(=O)(CCl)OC2=CC=C(C=C2)[N+](=O)[O-] |
| InChIKey | KDRPNFGJOVCCSH-UHFFFAOYSA-N |
Product Overview
4-Nitrophenyl chloromethyl(phenyl)phosphinate (CAS 940-93-2), with molecular formula C13H11ClNO4P and molecular weight 311.0114 g/mol. IUPAC: 1-[chloromethyl(phenyl)phosphoryl]oxy-4-nitrobenzene.