2-(4-Methyl-5-thiazolyl)ethyl hexanoate
2-(4-methyl-1,3-thiazol-5-yl)ethyl hexanoate
Also Known As: 2-(4-Methylthiazol-5-yl)ethyl hexanoate|Sulfurol hexanate|sulfuryl hexanoate|2-(4-Methyl-5-thiazolyl)ethyl Hexanoate|sulfurylhexanate|2- ethylhexanoate|2-(4-methyl-1,3-thiazol-5-yl)ethyl hexanoate|FEMA NO. 4279|EINECS 303-210-3|4-methyl-5-thiazolylethanylhexanoate|2-(4-Methylthiazol-5-yl)ethylhexanoate|KS-000011N9|5-(2-Hexanoyloxyethyl)-4-methylthiazole|Caproic acid 2-(4-methylthiazol-5-yl)ethyl ester|4,5-dimethyl-7-(1,3-thiazol-2-yl)heptanoate|159S327|2-(4-METHYL-5-THIAZOLYL)ETHYL HEXANOATE [FHFI]|hexanoic acid 2-(4-methyl-5-thiazolyl)ethyl ester|Hexanoicacid, 2-(4-methyl-5-thiazolyl)ethyl ester
| Molecular Formula | C12H19NO2S |
|---|---|
| Molecular Weight | 241.11365 g/mol |
| LogP | 3.11752 |
| Topological Polar Surface Area | 39.19 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 241.11365 |
| Monoisotopic Mass | 241.11365 |
| Heavy Atoms | 16 |
| Complexity | 322.57358 |
Chemical Identifiers
| CAS Number | 94159-32-7 |
|---|---|
| SMILES | CCCCCC(=O)OCCC1=C(N=CS1)C |
Product Overview
2-(4-Methyl-5-thiazolyl)ethyl hexanoate (CAS 94159-32-7), with molecular formula C12H19NO2S and molecular weight 241.11365 g/mol. IUPAC: 2-(4-methyl-1,3-thiazol-5-yl)ethyl hexanoate.