Benzyl o-chlorophenyl ether
1-chloro-2-phenylmethoxybenzene
Also Known As: 1-(Benzyloxy)-2-chlorobenzene|Benzyl 2-chlorophenyl ether|BENZYL O-CHLOROPHENYL ETHER|Ether, benzyl o-chlorophenyl-|Benzene, 1-chloro-2-(phenylmethoxy)-|o-Chlorophenylbenzyl ether|1-chloro-2-phenylmethoxybenzene|2-Chlorophenylbenzyl ether|Ether, benzyl ochlorophenyl|2-chlorophenyl benzyl ether|Ether, benzyl o-chlorophenyl|(2-Chlorophenyl)benzyl ether|1-benzyloxy-2-chloro-benzene|2-Chlorophenyl phenylmethyl ether|Benzene, 1chloro2(phenylmethoxy)|1-Chloro-2-[(phenylmethyl)oxy]benzene|BENZYL O-CHLOROPHENYL ETHER [HSDB]|1-Chloro-2-((phenylmethyl)oxy)benzene
| Molecular Formula | C13H11ClO |
|---|---|
| Molecular Weight | 218.04984 g/mol |
| LogP | 3.919 |
| Topological Polar Surface Area | 9.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 218.04984 |
| Monoisotopic Mass | 218.04984 |
| Heavy Atoms | 15 |
| Complexity | 425.5609 |
Chemical Identifiers
| CAS Number | 949-38-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2Cl |
Product Overview
Benzyl o-chlorophenyl ether (CAS 949-38-2), with molecular formula C13H11ClO and molecular weight 218.04984 g/mol. IUPAC: 1-chloro-2-phenylmethoxybenzene.