2-Chlorocinnamic acid
(E)-3-(2-chlorophenyl)prop-2-enoic acid
Also Known As: 2-Chlorocinnamic acid|o-Chlorocinnamic acid|(E)-3-(2-Chlorophenyl)acrylic acid|o-Chlorzimtsaure|3-(2-chlorophenyl)acrylic acid|2-Chlorocinnamicacid|CINNAMIC ACID, o-CHLORO-|-o-chlorocinnamicacid|2-Clorocinnamic acid|(E)-o-Chlorocinnamic acid|Baclofen Impurity 34|trans-2'-Chlorzimtsaure|2-Propenoic acid, 3-(2-chlorophenyl)-|trans-2-chlorocinnamic acid|(E)-3-(2-chlorophenyl)prop-2-enoic acid|3-(2-chlorophenyl)prop-2-enoic acid|(2E)-3-(2-chlorophenyl)acrylic acid|3-(2-Chlorophenyl)-2-propenoic acid|(E)-2-Chlorocinnamic acid|(2E)-3-(2-Chlorophenyl)-2-propenoic acid|(2E)-3-(2-chlorophenyl)prop-2-enoic acid|AKOS BBB/195|2-Chloro-trans-cinnamic acid|EINECS 213-363-7|EINECS 223-154-2|RARECHEM BK HC T319|2-(2-Chlorophenyl)propenoic acid|3-(2-chloro-phenyl)-acrylic acid|TIMTEC-BB SBB015306
| Molecular Formula | C9H7ClO2 |
|---|---|
| Molecular Weight | 182.01346 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 182.01346 |
| Monoisotopic Mass | 182.01346 |
| Heavy Atoms | 12 |
| Complexity | 189.0 |
Chemical Identifiers
| CAS Number | 95061-83-9 |
|---|---|
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)Cl |
| InChIKey | KJRRTHHNKJBVBO-AATRIKPKSA-N |
Patent-Derived Application Labels
Derived from 20 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Chlorocinnamic acid (CAS 95061-83-9), with molecular formula C9H7ClO2 and molecular weight 182.01346 g/mol. IUPAC: (E)-3-(2-chlorophenyl)prop-2-enoic acid.