![2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic Acid structure](/static/products/9549/95499-72-2.webp)
2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic Acid
2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic acid
Also Known As: 2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic Acid|2-(4-isobutylphenyl)-2-methylpropanoic acid|2-(4-Isobutylphenyl)-2-methylpropionic acid|Benzeneacetic acid, alpha,alpha-dimethyl-4-(2-methylpropyl)-|J1.482.565G|4-Isobutyl-alpha,alpha-dimethylbenzeneacetic acid|Benzeneaceticacid,-alpha-,-alpha--dimethyl-4- -|Benzeneacetic acid, -alpha-,-alpha--dimethyl-4-(2-methylpropyl)- (9CI)|Benzeneacetic acid,alpha,alpha-dimethyl-4-(2-methylpropyl)-
| Molecular Formula | C14H20O2 |
|---|---|
| Molecular Weight | 220.14633 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 220.14633 |
| Monoisotopic Mass | 220.14633 |
| Heavy Atoms | 16 |
| Complexity | 235.0 |
Chemical Identifiers
| CAS Number | 95499-72-2 |
|---|---|
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)(C)C(=O)O |
| InChIKey | AZPUUNIFABPZND-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic Acid (CAS 95499-72-2), with molecular formula C14H20O2 and molecular weight 220.14633 g/mol. IUPAC: 2-methyl-2-[4-(2-methylpropyl)phenyl]propanoic acid.