![5-{bis[4-(tert-butyl)benzyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile structure](/static/products/956/956691-68-2.png)
5-{bis[4-(tert-butyl)benzyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
5-[bis[(4-tert-butylphenyl)methyl]amino]-1-(4-methylphenyl)pyrazole-4-carbonitrile
Also Known As: KS-00003OQ5|MS-2817|5-{bis[4-(tert-butyl)benzyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile|5-[bis[(4-tert-butylphenyl)methyl]amino]-1-(4-methylphenyl)pyrazole-4-carbonitrile|5-{bis[(4-tert-butylphenyl)methyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
| Molecular Formula | C33H38N4 |
|---|---|
| Molecular Weight | 490.30966 g/mol |
| LogP | 7.8542 |
| Topological Polar Surface Area | 44.85 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 490.30966 |
| Monoisotopic Mass | 490.30966 |
| Heavy Atoms | 37 |
| Complexity | 1312.4415 |
Chemical Identifiers
| CAS Number | 956691-68-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)N2C(=C(C=N2)C#N)N(CC3=CC=C(C=C3)C(C)(C)C)CC4=CC=C(C=C4)C(C)(C)C |
Product Overview
5-{bis[4-(tert-butyl)benzyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile (CAS 956691-68-2), with molecular formula C33H38N4 and molecular weight 490.30966 g/mol. IUPAC: 5-[bis[(4-tert-butylphenyl)methyl]amino]-1-(4-methylphenyl)pyrazole-4-carbonitrile.
5-{bis[4-(tert-butyl)benzyl]amino}-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »