N'-(3-(4-Fluorophenyl)-5-isothiazolyl)-N-methoxy-N-methylurea
3-[3-(4-fluorophenyl)-1,2-thiazol-5-yl]-1-methoxy-1-methylurea
Also Known As: N'-(3-(4-Fluorophenyl)-5-isothiazolyl)-N-methoxy-N-methylurea|N'-[3-(4-Fluorophenyl)-5-isothiazolyl]-N-methoxy-N-methylurea|3-[3-(4-fluorophenyl)-1,2-thiazol-5-yl]-1-methoxy-1-methylurea|Urea, N'-(3-(4-fluorophenyl)-5-isothiazolyl)-N-methoxy-N-methyl-|3-[3-(4-fluorophenyl)-1,2-thiazol-5-yl]-1-methoxy-1-methyl-urea|N'-[3-(4-Fluorophenyl)-1,2-thiazol-5-yl]-N-methoxy-N-methylurea|Urea, N'-[3-(4-fluorophenyl)-5-isothiazolyl]-N-methoxy-N-methyl-
| Molecular Formula | C12H12FN3O2S |
|---|---|
| Molecular Weight | 281.06342 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 82.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 281.06342 |
| Monoisotopic Mass | 281.06342 |
| Heavy Atoms | 19 |
| Complexity | 313.0 |
Chemical Identifiers
| CAS Number | 96017-97-9 |
|---|---|
| SMILES | CN(C(=O)NC1=CC(=NS1)C2=CC=C(C=C2)F)OC |
| InChIKey | OPIOHFQVEWKHPK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N'-(3-(4-Fluorophenyl)-5-isothiazolyl)-N-methoxy-N-methylurea (CAS 96017-97-9), with molecular formula C12H12FN3O2S and molecular weight 281.06342 g/mol. IUPAC: 3-[3-(4-fluorophenyl)-1,2-thiazol-5-yl]-1-methoxy-1-methylurea.