4-(4-Amino-2-methylbenzyl)-3-methylbenzenamine
4-[(4-amino-2-methylphenyl)methyl]-3-methylaniline
Also Known As: 3,4'-Methylenedianiline|4- -3-methylbenzenamine|4,4'-Diaminoditolylmethan|2,4'-Diaminodiphenylmethane|4,2'-dimethyldiphenylmethane|m-Toluidine,4'-methylenedi-|4,4'-Methylenedi-m-toluidine|4-(4-amino-2-methylbenzyl)-3-methylbenzenamine|4,4'-methylenebis(3-methylaniline)|4-[(4-amino-2-methylphenyl)methyl]-3-methylaniline|Benzenamine,4'-methylenebis[3-methyl-|4,4 -Methylenebis(3-methylaniline)|3,3 -Dimethyl[4,4 -methylenedianiline]|3,3 -Dimethyl[4,4 -methylenebisaniline]|BENZENAMINE,4,4'-METHYLENEBIS[3-METHYL-
| Molecular Formula | C15H18N2 |
|---|---|
| Molecular Weight | 226.147 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 52.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 226.147 |
| Monoisotopic Mass | 226.147 |
| Heavy Atoms | 17 |
| Complexity | 217.0 |
Chemical Identifiers
| CAS Number | 97-28-9 |
|---|---|
| SMILES | CC1=C(C=CC(=C1)N)CC2=C(C=C(C=C2)N)C |
| InChIKey | YFKPQCYLWJULME-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(4-Amino-2-methylbenzyl)-3-methylbenzenamine (CAS 97-28-9), with molecular formula C15H18N2 and molecular weight 226.147 g/mol. IUPAC: 4-[(4-amino-2-methylphenyl)methyl]-3-methylaniline.