4,4-Dichloro-3-(dichloromethyl)crotonic acid methyl ester
methyl 4,4-dichloro-3-(dichloromethyl)but-2-enoate
Also Known As: 4,4-Dichloro-3-(dichloromethyl)crotonic acid methyl ester|methyl 4,4-dichloro-3-(dichloromethyl)but-2-enoate|Methyl 2,4,4-Dichloro-3-(dichloromethyl)crotonate|Methyl 3-(dichloromethyl)-4,4-dichloro-2-butenoate|Methyl 4,4-dichloro-3-(dichloromethyl)-2-butenoate|2,4,4-Dichloro-3-(dichloromethyl)-2-butenoic Acid Methyl Ester|Methyl 4,4-dichloro-3-(dichloromethyl)-2-butenoate #|3-(Dichloromethyl)-4,4-dichlorocrotonic acid methyl ester|METHYL 3-(DIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLATE|2,4,4-Dichloro-3-(dichloromethyl)-2-butenoic Acid Methyl Ester; Methyl 2,4,4-Dichloro-3-(dichloromethyl)crotonate;
| Molecular Formula | C6H6Cl4O2 |
|---|---|
| Molecular Weight | 249.91219 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 249.91219 |
| Monoisotopic Mass | 249.91219 |
| Heavy Atoms | 12 |
| Complexity | 178.0 |
Chemical Identifiers
| CAS Number | 97055-36-2 |
|---|---|
| SMILES | COC(=O)C=C(C(Cl)Cl)C(Cl)Cl |
| InChIKey | SDAXPQBGRAUIBB-UHFFFAOYSA-N |
Product Overview
4,4-Dichloro-3-(dichloromethyl)crotonic acid methyl ester (CAS 97055-36-2), with molecular formula C6H6Cl4O2 and molecular weight 249.91219 g/mol. IUPAC: methyl 4,4-dichloro-3-(dichloromethyl)but-2-enoate.