3-(3,5-Dichlorophenyl)propionic acid
3-(3,5-dichlorophenyl)propanoic acid
Also Known As: 3-(3,5-dichlorophenyl)propanoic acid|benzenepropanoic acid, 3,5-dichloro-|3-(3,5-Dichlorophenyl)propionic acid|ACMC-20anl7|3-(3,5-DICHLORO-PHENYL)-PROPIONIC ACID|3,5-Dichloro-benzenepropanoic acid|3- -PROPIONICACID|3-(3,5-Dichlorophenyl)propanoicacid|6410AC|3-(3',5'-dichlorophenyl)propanoic acid|3-(3,5-di-chlorophenyl)propionic acid|3-(3,5-Dichloro-phenyl)-propionicacid|3-(3,5-dichlorophenyl)-propionic acid|3-(35-DICHLROPHENL)PROPIONI 5G.|3-(3,5-Dichlorophenyl)propionic acid 97%|3-(35-DICHLROPHENL)PROPION 25G.|3-(3,5-Dichlorophenyl)propionic acid, 97%|J2.410.631D|X-1854|3-(3,5-DICHLORO-PHENYL)-PROPANOIC ACID|AJ-087/41885624|F2167-9451
| Molecular Formula | C9H8Cl2O2 |
|---|---|
| Molecular Weight | 217.99013 g/mol |
| LogP | 3.0106 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 217.99013 |
| Monoisotopic Mass | 217.99013 |
| Heavy Atoms | 13 |
| Complexity | 303.14078 |
Chemical Identifiers
| CAS Number | 97151-23-0 |
|---|---|
| SMILES | C1=C(C=C(C=C1Cl)Cl)CCC(=O)O |
Product Overview
3-(3,5-Dichlorophenyl)propionic acid (CAS 97151-23-0), with molecular formula C9H8Cl2O2 and molecular weight 217.99013 g/mol. IUPAC: 3-(3,5-dichlorophenyl)propanoic acid.