2,5-Dichlorophenyl methyl phenylphosphonate
1,4-dichloro-2-[methoxy(phenyl)phosphoryl]oxybenzene
Also Known As: 2,5-Dichlorophenyl methyl phenylphosphonate|(S)-Phenylphosphonic acid 2,5-dichlorophenyl methyl ester|(R)-Phenylphosphonic acid 2,5-dichlorophenyl methyl ester|(+-)-Phenylphosphonic acid 2,5-dichlorophenyl methyl ester|Phosphonic acid, phenyl-, 2,5-dichlorophenyl methyl ester|Phosphonic acid, phenyl-, 2,5-dichlorophenyl methyl ester, (+-)-|Phosphonic acid, phenyl-, 2,5-dichlorophenyl methyl ester, (R)-|Phosphonic acid, phenyl-, 2,5-dichlorophenyl methyl ester, (S)-|1,4-dichloro-2-(methoxy-phenyl-phosphoryl)oxy-benzene|1,4-dichloro-2-[methoxy(phenyl)phosphoryl]oxybenzene
| Molecular Formula | C13H11Cl2O3P |
|---|---|
| Molecular Weight | 315.9823 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 315.9823 |
| Monoisotopic Mass | 315.9823 |
| Heavy Atoms | 19 |
| Complexity | 334.0 |
Chemical Identifiers
| CAS Number | 97232-57-0 |
|---|---|
| SMILES | COP(=O)(C1=CC=CC=C1)OC2=C(C=CC(=C2)Cl)Cl |
| InChIKey | CTFGBIJKVBZCHE-UHFFFAOYSA-N |
Product Overview
2,5-Dichlorophenyl methyl phenylphosphonate (CAS 97232-57-0), with molecular formula C13H11Cl2O3P and molecular weight 315.9823 g/mol. IUPAC: 1,4-dichloro-2-[methoxy(phenyl)phosphoryl]oxybenzene.