![Acetic acid, [4-(1-hydroxy-1-methylethyl)cyclohex-1-enyl]methyl ester structure](/static/products/972/97259-73-9.png)
Acetic acid, [4-(1-hydroxy-1-methylethyl)cyclohex-1-enyl]methyl ester
[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methyl acetate
Also Known As: 7-acetoxy-p-menth-1-en-8-ol|[4-(2-hydroxypropyl)cyclohexen-1-yl]methyl acetate|4-(2-Hydroxy-2-propyl)cyclohexene-1-methyl acetate|[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methyl acetate|Acetic acid, [4-(1-hydroxy-1-methylethyl)cyclohex-1-enyl]methyl ester|[4-(2-hydroxypropan-2-yl)cyclohex-1-en-1-yl]methyl acetate|[4-(1-Hydroxy-1-methylethyl)-1-cyclohexen-1-yl]methyl acetate #|Acetic acid [4-(1-hydroxy-1-methylethyl)-1-cyclohexenyl]methyl ester
| Molecular Formula | C12H20O3 |
|---|---|
| Molecular Weight | 212.14125 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 212.14125 |
| Monoisotopic Mass | 212.14125 |
| Heavy Atoms | 15 |
| Complexity | 266.0 |
Chemical Identifiers
| CAS Number | 97259-73-9 |
|---|---|
| SMILES | CC(=O)OCC1=CCC(CC1)C(C)(C)O |
| InChIKey | GAJGPKMCPGWYGC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Acetic acid, [4-(1-hydroxy-1-methylethyl)cyclohex-1-enyl]methyl ester (CAS 97259-73-9), with molecular formula C12H20O3 and molecular weight 212.14125 g/mol. IUPAC: [4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]methyl acetate.