Mecoprop-trolamine
2-[bis(2-hydroxyethyl)amino]ethanol;2-(4-chloro-2-methylphenoxy)propanoic acid
Also Known As: Mecoprop-trolamine|Caswell No. 559A|Mecoprop-trolamine [ISO]|Mecoprop trolamine salt|EINECS 307-409-6|EINECS 258-535-2|EPA Pesticide Chemical Code 031516|Tris(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate|Tris(2-hydroxyethyl)ammonium (1)-2-(4-chloro-2-methylphenoxy)propionate|2-(2-Methyl-4-chlorophenoxy)propionic acid, diethanolamine salt|Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1)|Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1)|Tris(2-hydroxyethyl)ammonium (+-)-2-(4-chloro-2-methylphenoxy)propionate|2-(4-Chloro-2-methylphenoxy)propanoic acid--2,2',2''-nitrilotri(ethan-1-ol) (1/1)|2-[bis(2-hydroxyethyl)amino]ethanol; 2-(4-chloro-2-methylphenoxy)propanoic acid
| Molecular Formula | C16H26ClNO6 |
|---|---|
| Molecular Weight | 363.14487 g/mol |
| LogP | 0.76562 |
| Topological Polar Surface Area | 110.46 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Exact Mass | 363.14487 |
| Monoisotopic Mass | 363.14487 |
| Heavy Atoms | 24 |
| Complexity | 471.37082 |
Chemical Identifiers
| CAS Number | 97635-48-8 |
|---|---|
| SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O.C(CO)N(CCO)CCO |
Product Overview
Mecoprop-trolamine (CAS 97635-48-8), with molecular formula C16H26ClNO6 and molecular weight 363.14487 g/mol. IUPAC: 2-[bis(2-hydroxyethyl)amino]ethanol;2-(4-chloro-2-methylphenoxy)propanoic acid.