Acetamide, 2-((2-(diethylamino)ethyl)amino)-N-(2-norbornanyl)-, hydrochloride
N-(2-bicyclo[2.2.1]heptanyl)-2-[2-(diethylamino)ethylamino]acetamide;hydrochloride
Also Known As: ERL 385|LS-8955|2-((2-(Diethylamino)ethyl)amino)-N-(2-norbornanyl)acetamide hydrochloride|Acetamide, 2-((2-(diethylamino)ethyl)amino)-N-(2-norbornanyl)-, hydrochloride|N-(3-bicyclo[2.2.1]heptanyl)-2-(2-diethylaminoethylamino)acetamide hydrochloride|N-(Bicyclo[2.2.1]heptan-2-yl)-2-{[2-(diethylamino)ethyl]amino}ethanimidic acid--hydrogen chloride (1/1)|N-(Bicyclo[2.2.1]heptan-2-yl){[2-(diethylamino)ethyl]amino}ethanimidic acid--hydrogen chloride (1/1)
| Molecular Formula | C15H30ClN3O |
|---|---|
| Molecular Weight | 303.20773 g/mol |
| LogP | 1.6444 |
| Topological Polar Surface Area | 44.37 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Exact Mass | 303.20773 |
| Monoisotopic Mass | 303.20773 |
| Heavy Atoms | 20 |
| Complexity | 296.8432 |
Chemical Identifiers
| CAS Number | 97702-90-4 |
|---|---|
| SMILES | CCN(CC)CCNCC(=O)NC1CC2CCC1C2.Cl |
Product Overview
Acetamide, 2-((2-(diethylamino)ethyl)amino)-N-(2-norbornanyl)-, hydrochloride (CAS 97702-90-4), with molecular formula C15H30ClN3O and molecular weight 303.20773 g/mol. IUPAC: N-(2-bicyclo[2.2.1]heptanyl)-2-[2-(diethylamino)ethylamino]acetamide;hydrochloride.