2-(2,4-Dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy]propanoate
2-(2,4-dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy]propanoate
Also Known As: 2-(2,4-dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy]propanoate|2-(2,4-dichlorophenoxy)ethyl 2-{[(3-methylphenyl)carbamoyl]oxy}propanoate|2-(2,4-dichlorophenoxy)ethyl 2-(m-tolylcarbamoyloxy)propanoate|2-(2,4-dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy|Carbanilic acid, 2,5-m-methyl-, ester with 2-(2,4-dichloro-phenoxy)ethyl lactate|Propanoic acid,2-[[[(3-methylphenyl)amino]carbonyl]oxy]-, 2-(2,4-dichlorophenoxy)ethyl ester
| Molecular Formula | C19H19Cl2NO5 |
|---|---|
| Molecular Weight | 411.06403 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 73.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 411.06403 |
| Monoisotopic Mass | 411.06403 |
| Heavy Atoms | 27 |
| Complexity | 493.0 |
Chemical Identifiers
| CAS Number | 97993-76-5 |
|---|---|
| SMILES | CC1=CC(=CC=C1)NC(=O)OC(C)C(=O)OCCOC2=C(C=C(C=C2)Cl)Cl |
| InChIKey | MRVSREAYAYGTJA-UHFFFAOYSA-N |
Product Overview
2-(2,4-Dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy]propanoate (CAS 97993-76-5), with molecular formula C19H19Cl2NO5 and molecular weight 411.06403 g/mol. IUPAC: 2-(2,4-dichlorophenoxy)ethyl 2-[(3-methylphenyl)carbamoyloxy]propanoate.