(1S,6S,7S)-1,4-Dimethylbicyclo(4.1.0)hept-3-ene-7-carboxylic acid
(1S,6S,7S)-1,4-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid
Also Known As: (1S,6S,7S)-1,4-Dimethylbicyclo(4.1.0)hept-3-ene-7-carboxylic acid|Bicyclo(4.1.0)hept-3-ene-7-carboxylic acid, 1,4-dimethyl-, (1S-(1alpha,6alpha,7alpha))-|(1S,6S,7R)-1,4-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic Acid|(1S,6S,7S)-3,6-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid
| Molecular Formula | C10H14O2 |
|---|---|
| Molecular Weight | 166.09938 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 166.09938 |
| Monoisotopic Mass | 166.09938 |
| Heavy Atoms | 12 |
| Complexity | 267.0 |
Chemical Identifiers
| CAS Number | 98875-00-4 |
|---|---|
| SMILES | CC1=CC[C@]2([C@@H](C1)[C@@H]2C(=O)O)C |
| InChIKey | CZDWEPMNMRFZOA-XKSSXDPKSA-N |
Product Overview
(1S,6S,7S)-1,4-Dimethylbicyclo(4.1.0)hept-3-ene-7-carboxylic acid (CAS 98875-00-4), with molecular formula C10H14O2 and molecular weight 166.09938 g/mol. IUPAC: (1S,6S,7S)-1,4-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid.
(1S,6S,7S)-1,4-Dimethylbicyclo(4.1.0)hept-3-ene-7-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »