(1S,5S,6R)-3-Methylbicyclo(3.1.0)hex-3-ene-6-carbonyl chloride
(1S,5S,6R)-3-methylbicyclo[3.1.0]hex-2-ene-6-carbonyl chloride
Also Known As: (1S,5S,6R)-3-Methylbicyclo(3.1.0)hex-3-ene-6-carbonyl chloride|(1R,5S,6R)-3-methylbicyclo[3.1.0]hex-3-ene-6-carbonyl Chloride|(1S,5S,6R)-3-methylbicyclo[3.1.0]hex-3-ene-6-carbonyl chloride|Bicyclo(3.1.0)hex-2-ene-6-carbonyl chloride, 3-methyl-, (1S-(1alpha,5alpha,6alpha))-|Bicyclo[3.1.0]hex-2-ene-6-carbonyl chloride, 3-methyl-, [1S-(1alpha,5alpha,6alpha)]- (9CI)
| Molecular Formula | C8H9ClO |
|---|---|
| Molecular Weight | 156.0342 g/mol |
| LogP | 1.6 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 156.0342 |
| Monoisotopic Mass | 156.0342 |
| Heavy Atoms | 10 |
| Complexity | 219.0 |
Chemical Identifiers
| CAS Number | 98875-01-5 |
|---|---|
| SMILES | CC1=C[C@@H]2[C@H](C1)[C@H]2C(=O)Cl |
| InChIKey | MKFVRCBLWIBNLD-VQVTYTSYSA-N |
Product Overview
(1S,5S,6R)-3-Methylbicyclo(3.1.0)hex-3-ene-6-carbonyl chloride (CAS 98875-01-5), with molecular formula C8H9ClO and molecular weight 156.0342 g/mol. IUPAC: (1S,5S,6R)-3-methylbicyclo[3.1.0]hex-2-ene-6-carbonyl chloride.
(1S,5S,6R)-3-Methylbicyclo(3.1.0)hex-3-ene-6-carbonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »