(1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride
(1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride
Also Known As: 3,6-Dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride|Bicyclo(4.1.0)hept-2-ene-7-carbonyl chloride, 3,6-dimethyl-, (1alpha,6alpha,7beta)-|(1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride|Bicyclo[4.1.0]hept-2-ene-7-carbonylchloride,3,6-dimethyl-, -|(1R,6S,7S)-1,4-dimethylbicyclo[4.1.0]hept-4-ene-7-carbonyl Chloride|Bicyclo[4.1.0]hept-2-ene-7-carbonyl chloride, 3,6-dimethyl-, (1alpha,6alpha,7beta)- (9CI)
| Molecular Formula | C10H13ClO |
|---|---|
| Molecular Weight | 184.06549 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 184.06549 |
| Monoisotopic Mass | 184.06549 |
| Heavy Atoms | 12 |
| Complexity | 269.0 |
Chemical Identifiers
| CAS Number | 98973-72-9 |
|---|---|
| SMILES | CC1=C[C@@H]2[C@@H]([C@@]2(CC1)C)C(=O)Cl |
| InChIKey | FIGFUHYDKWUBQU-NQMVMOMDSA-N |
Product Overview
(1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride (CAS 98973-72-9), with molecular formula C10H13ClO and molecular weight 184.06549 g/mol. IUPAC: (1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride.
(1R,6R,7S)-3,6-dimethylbicyclo[4.1.0]hept-2-ene-7-carbonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »