Tetrabenzyl pyrophosphate
dibenzyl bis(phenylmethoxy)phosphoryl phosphate
Also Known As: Tetrabenzyl pyrophosphate|Tetrabenzyl diphosphate|Tetrabutylgermane|Benzyl Pyrophosphate|Tetrabenzylpyrophosphate|Tetrabenzyldiphosphate|Pyrophosphoric acid tetrabenzyl ester|ACMC-209sbp|Fosaprepitant Impurity S|tetra benzyl pyrophosphate|Tetrabenzyl diphosphate #|Fosaprepitant Impurity 38|dibenzyl {[bis(benzyloxy)phosphoryl]oxy}phosphonate|Diphosphoric acid tetrabenzyl ester|dibenzyl bis(phenylmethoxy)phosphoryl phosphate|Tetrabenzyl pyrophosphate, 98%|AMY7002|dibenzyl dibenzyloxyphosphoryl phosphate|KS-000001YP|Diphosphoric acid, tetrakis(phenylmethyl) ester|QC-591|Oxybis(phosphonic acid dibenzyl) ester|GS-0918
| Molecular Formula | C28H28O7P2 |
|---|---|
| Molecular Weight | 538.13104 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 80.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Exact Mass | 538.13104 |
| Monoisotopic Mass | 538.13104 |
| Heavy Atoms | 37 |
| Complexity | 612.0 |
Chemical Identifiers
| CAS Number | 990-91-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
| InChIKey | NSBNXCZCLRBQTA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Tetrabenzyl pyrophosphate (CAS 990-91-0), with molecular formula C28H28O7P2 and molecular weight 538.13104 g/mol. IUPAC: dibenzyl bis(phenylmethoxy)phosphoryl phosphate.