Cyclopentyl-(4-fluoro-benzyl)-amine
N-[(4-fluorophenyl)methyl]cyclopentanamine
Also Known As: Cyclopentyl-(4-fluoro-benzyl)-amine|N-[(4-fluorophenyl)methyl]cyclopentanamine|N-(4-fluorobenzyl)cyclopentanamine|N-Cyclopentyl-4-fluoro-benzylamine|N-4-fluorobenzyl-N-cyclopentylamine|cyclopentyl-(4-fluorobenzyl)amine|N-(4-Fluorobenzyl)cyclopentylamine|0901AF|BAS 05541904|N-cyclopentyl-N-(4-fluorobenzyl)amine|Cyclopentyl(4-fluorobenzyl)amine =97%|cyclopentyl[(4-fluorophenyl)methyl]amine|2-(n,n-dimethylaminomethyl)phenyl-boronic acid|AN-465/41989749|N-(4-FLROBENZYL)CYCLOPENTYLAMINE 97% 1G|N-(4-FLROBENZL)CYCLOPNTYLAMINE 97% 250MG|2-[(BENZO[1,3]DIOXOL-5-YLMETHYL)-AMINO]-ETHANOL HYDROCHLORIDE
| Molecular Formula | C12H16FN |
|---|---|
| Molecular Weight | 193.12668 g/mol |
| LogP | 2.8579 |
| Topological Polar Surface Area | 12.03 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 193.12668 |
| Monoisotopic Mass | 193.12668 |
| Heavy Atoms | 14 |
| Complexity | 274.87814 |
Chemical Identifiers
| CAS Number | 99075-94-2 |
|---|---|
| SMILES | C1CCC(C1)NCC2=CC=C(C=C2)F |
Product Overview
Cyclopentyl-(4-fluoro-benzyl)-amine (CAS 99075-94-2), with molecular formula C12H16FN and molecular weight 193.12668 g/mol. IUPAC: N-[(4-fluorophenyl)methyl]cyclopentanamine.
Cyclopentyl-(4-fluoro-benzyl)-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »